| Name |
rac-9-tert-butyl 4-(1,3-dioxo-2,3-dihydro-1H-isoindol-2-yl) (1R,2S,4R,6S)-9-azatricyclo[4.2.1.0,2,4]nonane-4,9-dicarboxylate
|
| Molecular Formula |
C22H24N2O6
|
| Molecular Weight |
412.4
|
| Smiles |
CC(C)(C)OC(=O)N1C2CCC1C1CC1(C(=O)ON1C(=O)c3ccccc3C1=O)C2
|
CC(C)(C)OC(=O)N1C2CCC1C1CC1(C(=O)ON1C(=O)c3ccccc3C1=O)C2
The content on this webpage is sourced from various professional data sources. If you have any questions or concerns regarding the content, please feel free to contact service1@chemsrc.com.