| Name |
1,3-dioxo-2,3-dihydro-1H-isoindol-2-yl 3-(2,6-difluorophenyl)-4,5-dihydro-1,2-oxazole-5-carboxylate
|
| Molecular Formula |
C18H10F2N2O5
|
| Molecular Weight |
372.3
|
| Smiles |
O=C(ON1C(=O)c2ccccc2C1=O)C1CC(c2c(F)cccc2F)=NO1
|
O=C(ON1C(=O)c2ccccc2C1=O)C1CC(c2c(F)cccc2F)=NO1
The content on this webpage is sourced from various professional data sources. If you have any questions or concerns regarding the content, please feel free to contact service1@chemsrc.com.