| Name |
(9H-fluoren-9-yl)methyl (3S)-3-{2-[(1,3-dioxo-2,3-dihydro-1H-isoindol-2-yl)oxy]-2-oxoethyl}piperidine-1-carboxylate
|
| Molecular Formula |
C30H26N2O6
|
| Molecular Weight |
510.5
|
| Smiles |
O=C(CC1CCCN(C(=O)OCC2c3ccccc3-c3ccccc32)C1)ON1C(=O)c2ccccc2C1=O
|
O=C(CC1CCCN(C(=O)OCC2c3ccccc3-c3ccccc32)C1)ON1C(=O)c2ccccc2C1=O
The content on this webpage is sourced from various professional data sources. If you have any questions or concerns regarding the content, please feel free to contact service1@chemsrc.com.