| Name |
2-(1,3-dioxo-2,3-dihydro-1H-isoindol-2-yl) 1-(9H-fluoren-9-yl)methyl (2S)-4,4-difluoropyrrolidine-1,2-dicarboxylate
|
| Molecular Formula |
C28H20F2N2O6
|
| Molecular Weight |
518.5
|
| Smiles |
O=C(ON1C(=O)c2ccccc2C1=O)C1CC(F)(F)CN1C(=O)OCC1c2ccccc2-c2ccccc21
|
O=C(ON1C(=O)c2ccccc2C1=O)C1CC(F)(F)CN1C(=O)OCC1c2ccccc2-c2ccccc21
The content on this webpage is sourced from various professional data sources. If you have any questions or concerns regarding the content, please feel free to contact service1@chemsrc.com.