| Name |
3-({1-[(4-bromophenyl)methyl]-1H-1,2,3-triazol-4-yl}methyl)-1,3-diazaspiro[4.4]nonane-2,4-dione
|
| Molecular Formula |
C17H18BrN5O2
|
| Molecular Weight |
404.3
|
| Smiles |
O=C1NC2(CCCC2)C(=O)N1Cc1cn(Cc2ccc(Br)cc2)nn1
|
O=C1NC2(CCCC2)C(=O)N1Cc1cn(Cc2ccc(Br)cc2)nn1
The content on this webpage is sourced from various professional data sources. If you have any questions or concerns regarding the content, please feel free to contact service1@chemsrc.com.