| Name |
1-{[3-Fluoro-4-(trifluoromethyl)phenyl]methyl}cyclopropane-1-carboxylic acid
|
| Molecular Formula |
C12H10F4O2
|
| Molecular Weight |
262.20
|
| Smiles |
O=C(O)C1(Cc2ccc(C(F)(F)F)c(F)c2)CC1
|
O=C(O)C1(Cc2ccc(C(F)(F)F)c(F)c2)CC1
The content on this webpage is sourced from various professional data sources. If you have any questions or concerns regarding the content, please feel free to contact service1@chemsrc.com.