| Name |
3-(4,6-Dichloropyrimidin-5-yl)-4,4-difluorobutanoic acid
|
| Molecular Formula |
C8H6Cl2F2N2O2
|
| Molecular Weight |
271.04
|
| Smiles |
O=C(O)CC(c1c(Cl)ncnc1Cl)C(F)F
|
O=C(O)CC(c1c(Cl)ncnc1Cl)C(F)F
The content on this webpage is sourced from various professional data sources. If you have any questions or concerns regarding the content, please feel free to contact service1@chemsrc.com.