| Name |
4-(1,3-dioxo-2,3-dihydro-1H-isoindol-2-yl) 1-(9H-fluoren-9-yl)methyl 4-(2-methylpropyl)piperidine-1,4-dicarboxylate
|
| Molecular Formula |
C33H32N2O6
|
| Molecular Weight |
552.6
|
| Smiles |
CC(C)CC1(C(=O)ON2C(=O)c3ccccc3C2=O)CCN(C(=O)OCC2c3ccccc3-c3ccccc32)CC1
|
CC(C)CC1(C(=O)ON2C(=O)c3ccccc3C2=O)CCN(C(=O)OCC2c3ccccc3-c3ccccc32)CC1
The content on this webpage is sourced from various professional data sources. If you have any questions or concerns regarding the content, please feel free to contact service1@chemsrc.com.