| Name |
2-azido-1-(1-ethyl-1H-1,2,3-triazol-4-yl)ethan-1-ol
|
| Molecular Formula |
C6H10N6O
|
| Molecular Weight |
182.18
|
| Smiles |
CCn1cc(C(O)CN=[N+]=[N-])nn1
|
CCn1cc(C(O)CN=[N+]=[N-])nn1
The content on this webpage is sourced from various professional data sources. If you have any questions or concerns regarding the content, please feel free to contact service1@chemsrc.com.