| Name |
Cholesta-8,24-diene-3,6-diol, 14-methyl-, (3I(2),5I+/-,6I+/-)-
|
| Molecular Formula |
C28H46O2
|
| Molecular Weight |
414.7
|
| Smiles |
CC(C)=CCCC(C)C1CCC2(C)C3=C(CCC12C)C1(C)CCC(O)CC1C(O)C3
|
CC(C)=CCCC(C)C1CCC2(C)C3=C(CCC12C)C1(C)CCC(O)CC1C(O)C3
The content on this webpage is sourced from various professional data sources. If you have any questions or concerns regarding the content, please feel free to contact service1@chemsrc.com.