| Name |
2-Benzyl-10a-methyl-1,2,3,3a,4,10a-hexahydrobenzo[e]pyrrolo[3,4-b]azepine-5,10-dione
|
| Molecular Formula |
C20H20N2O2
|
| Molecular Weight |
320.4
|
| Smiles |
CC12CN(Cc3ccccc3)CC1NC(=O)c1ccccc1C2=O
|
CC12CN(Cc3ccccc3)CC1NC(=O)c1ccccc1C2=O
The content on this webpage is sourced from various professional data sources. If you have any questions or concerns regarding the content, please feel free to contact service1@chemsrc.com.