| Name |
2-[3-(2,2,2-trifluoroacetamido)-1H-1,2,4-triazol-1-yl]acetic acid
|
| Molecular Formula |
C6H5F3N4O3
|
| Molecular Weight |
238.12
|
| Smiles |
O=C(O)Cn1cnc(NC(=O)C(F)(F)F)n1
|
O=C(O)Cn1cnc(NC(=O)C(F)(F)F)n1
The content on this webpage is sourced from various professional data sources. If you have any questions or concerns regarding the content, please feel free to contact service1@chemsrc.com.