| Name |
[(3aR,6R,6aR)-4-[6-chloro-4-[[(1R)-1-phenylethyl]amino]pyrazolo[3,4-d]pyrimidin-1-yl]-2,2-dimethyl-3a,4,6,6a-tetrahydrofuro[3,4-d][1,3]dioxol-6-yl]methanol
|
| Molecular Formula |
C21H24ClN5O4
|
| Molecular Weight |
445.9
|
| Smiles |
CC(Nc1nc(Cl)nc2c1cnn2C1OC(CO)C2OC(C)(C)OC21)c1ccccc1
|
CC(Nc1nc(Cl)nc2c1cnn2C1OC(CO)C2OC(C)(C)OC21)c1ccccc1
The content on this webpage is sourced from various professional data sources. If you have any questions or concerns regarding the content, please feel free to contact service1@chemsrc.com.