| Name |
Diphenyl(5,5,6,6,7,7,8,8,9,9,9-undecafluoro-1-iodononan-3-yl)phosphine oxide
|
| Molecular Formula |
C21H17F11IOP
|
| Molecular Weight |
652.2
|
| Smiles |
O=P(c1ccccc1)(c1ccccc1)C(CCI)CC(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)F
|
O=P(c1ccccc1)(c1ccccc1)C(CCI)CC(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)F
The content on this webpage is sourced from various professional data sources. If you have any questions or concerns regarding the content, please feel free to contact service1@chemsrc.com.