| Name |
(4S,4'S)-2,2'-(1,3-Bis(3,5-di-tert-butylphenyl)propane-2,2-diyl)bis(4-isopropyl-4,5-dihydrooxazole)
|
| Molecular Formula |
C43H66N2O2
|
| Molecular Weight |
643.0
|
| Smiles |
CC(C)C1COC(C(Cc2cc(C(C)(C)C)cc(C(C)(C)C)c2)(Cc2cc(C(C)(C)C)cc(C(C)(C)C)c2)C2=NC(C(C)C)CO2)=N1
|
CC(C)C1COC(C(Cc2cc(C(C)(C)C)cc(C(C)(C)C)c2)(Cc2cc(C(C)(C)C)cc(C(C)(C)C)c2)C2=NC(C(C)C)CO2)=N1
The content on this webpage is sourced from various professional data sources. If you have any questions or concerns regarding the content, please feel free to contact service1@chemsrc.com.