| Name |
8-(1,3-Dichloropropan-2-yl)-1,4-dioxaspiro[4.5]decane
|
| Molecular Formula |
C11H18Cl2O2
|
| Molecular Weight |
253.16
|
| Smiles |
ClCC(CCl)C1CCC2(CC1)OCCO2
|
ClCC(CCl)C1CCC2(CC1)OCCO2
The content on this webpage is sourced from various professional data sources. If you have any questions or concerns regarding the content, please feel free to contact service1@chemsrc.com.