| Name |
2-[4-({[(9H-fluoren-9-yl)methoxy]carbonyl}amino)-4-methyl-N-(2,2,2-trifluoroethyl)pentanamido]acetic acid
|
| Molecular Formula |
C25H27F3N2O5
|
| Molecular Weight |
492.5
|
| Smiles |
CC(C)(CCC(=O)N(CC(=O)O)CC(F)(F)F)NC(=O)OCC1c2ccccc2-c2ccccc21
|
CC(C)(CCC(=O)N(CC(=O)O)CC(F)(F)F)NC(=O)OCC1c2ccccc2-c2ccccc21
The content on this webpage is sourced from various professional data sources. If you have any questions or concerns regarding the content, please feel free to contact service1@chemsrc.com.