| Name |
4-Benzyl 5-methyl 8-bromo-2,3,4,5-tetrahydro-1,4-benzoxazepine-4,5-dicarboxylate
|
| Molecular Formula |
C19H18BrNO5
|
| Molecular Weight |
420.3
|
| Smiles |
COC(=O)C1c2ccc(Br)cc2OCCN1C(=O)OCc1ccccc1
|
COC(=O)C1c2ccc(Br)cc2OCCN1C(=O)OCc1ccccc1
The content on this webpage is sourced from various professional data sources. If you have any questions or concerns regarding the content, please feel free to contact service1@chemsrc.com.