| Name |
2-methoxy-2-{1-methyl-1H-pyrrolo[2,3-b]pyridin-3-yl}propan-1-amine
|
| Molecular Formula |
C12H17N3O
|
| Molecular Weight |
219.28
|
| Smiles |
COC(C)(CN)c1cn(C)c2ncccc12
|
COC(C)(CN)c1cn(C)c2ncccc12
The content on this webpage is sourced from various professional data sources. If you have any questions or concerns regarding the content, please feel free to contact service1@chemsrc.com.