| Name |
2-(2-Cyclopropyl-1,3-thiazol-4-yl)-3,3,3-trifluoropropan-1-amine
|
| Molecular Formula |
C9H11F3N2S
|
| Molecular Weight |
236.26
|
| Smiles |
NCC(c1csc(C2CC2)n1)C(F)(F)F
|
NCC(c1csc(C2CC2)n1)C(F)(F)F
The content on this webpage is sourced from various professional data sources. If you have any questions or concerns regarding the content, please feel free to contact service1@chemsrc.com.