| Name |
1H-Indol-7-ol, 5-(2,3,5-trichlorophenyl)-
|
| Molecular Formula |
C14H8Cl3NO
|
| Molecular Weight |
312.6
|
| Smiles |
Oc1cc(-c2cc(Cl)cc(Cl)c2Cl)cc2cc[nH]c12
|
Oc1cc(-c2cc(Cl)cc(Cl)c2Cl)cc2cc[nH]c12
The content on this webpage is sourced from various professional data sources. If you have any questions or concerns regarding the content, please feel free to contact service1@chemsrc.com.