| Name |
6-methanesulfonyl-1,3-dimethyl-1H,2H,3H,4H-pyrido[2,3-d]pyrimidine-2,4-dione
|
| Molecular Formula |
C10H11N3O4S
|
| Molecular Weight |
269.28
|
| Smiles |
Cn1c(=O)c2cc(S(C)(=O)=O)cnc2n(C)c1=O
|
Cn1c(=O)c2cc(S(C)(=O)=O)cnc2n(C)c1=O
The content on this webpage is sourced from various professional data sources. If you have any questions or concerns regarding the content, please feel free to contact service1@chemsrc.com.