| Name |
N-(2-hydroxy-3-{methyl[(pyridin-4-yl)methyl]amino}propyl)prop-2-enamide
|
| Molecular Formula |
C13H19N3O2
|
| Molecular Weight |
249.31
|
| Smiles |
C=CC(=O)NCC(O)CN(C)Cc1ccncc1
|
C=CC(=O)NCC(O)CN(C)Cc1ccncc1
The content on this webpage is sourced from various professional data sources. If you have any questions or concerns regarding the content, please feel free to contact service1@chemsrc.com.