| Name |
(1R,4aS,4bR,10aR,10bR,12aS)-1-hydroxy-1,10a,12a-trimethyl-4,4a,4b,5,6,9,10,10b,11,12-decahydro-3H-chrysene-2,8-dione
|
| Molecular Formula |
C21H30O3
|
| Molecular Weight |
330.5
|
| Smiles |
CC12CCC(=O)C=C1CCC1C2CCC2(C)C1CCC(=O)C2(C)O
|
CC12CCC(=O)C=C1CCC1C2CCC2(C)C1CCC(=O)C2(C)O
The content on this webpage is sourced from various professional data sources. If you have any questions or concerns regarding the content, please feel free to contact service1@chemsrc.com.