| Name |
2-{[4-(dimethylamino)-2-({[(9H-fluoren-9-yl)methoxy]carbonyl}amino)butanamido]methyl}cyclopropane-1-carboxylic acid
|
| Molecular Formula |
C26H31N3O5
|
| Molecular Weight |
465.5
|
| Smiles |
CN(C)CCC(NC(=O)OCC1c2ccccc2-c2ccccc21)C(=O)NCC1CC1C(=O)O
|
CN(C)CCC(NC(=O)OCC1c2ccccc2-c2ccccc21)C(=O)NCC1CC1C(=O)O
The content on this webpage is sourced from various professional data sources. If you have any questions or concerns regarding the content, please feel free to contact service1@chemsrc.com.