| Name |
2-(Benzenesulfonyl)-7-chloro-6-methyl-1,3,4,4a,5,5a,6,7,8,9,9a,10a-dodecahydrobenzo[b][1,6]naphthyridin-10-one
|
| Molecular Formula |
C19H25ClN2O3S
|
| Molecular Weight |
396.9
|
| Smiles |
CC1C(Cl)CCC2C(=O)C3CN(S(=O)(=O)c4ccccc4)CCC3NC21
|
CC1C(Cl)CCC2C(=O)C3CN(S(=O)(=O)c4ccccc4)CCC3NC21
The content on this webpage is sourced from various professional data sources. If you have any questions or concerns regarding the content, please feel free to contact service1@chemsrc.com.