| Name |
1,3-dioxo-2,3-dihydro-1H-isoindol-2-yl 2-(cyanomethyl)benzoate
|
| Molecular Formula |
C17H10N2O4
|
| Molecular Weight |
306.27
|
| Smiles |
N#CCc1ccccc1C(=O)ON1C(=O)c2ccccc2C1=O
|
N#CCc1ccccc1C(=O)ON1C(=O)c2ccccc2C1=O
The content on this webpage is sourced from various professional data sources. If you have any questions or concerns regarding the content, please feel free to contact service1@chemsrc.com.