| Name |
5-Amino-3-(difluoromethyl)-2,3-dihydro-1,3-benzoxazol-2-one
|
| Molecular Formula |
C8H6F2N2O2
|
| Molecular Weight |
200.14
|
| Smiles |
Nc1ccc2oc(=O)n(C(F)F)c2c1
|
Nc1ccc2oc(=O)n(C(F)F)c2c1
The content on this webpage is sourced from various professional data sources. If you have any questions or concerns regarding the content, please feel free to contact service1@chemsrc.com.