| Name |
4-(fluoromethyl)-1-{3-phenyl-3H-[1,2,3]triazolo[4,5-d]pyrimidin-7-yl}piperidine
|
| Molecular Formula |
C16H17FN6
|
| Molecular Weight |
312.34
|
| Smiles |
FCC1CCN(c2ncnc3c2nnn3-c2ccccc2)CC1
|
FCC1CCN(c2ncnc3c2nnn3-c2ccccc2)CC1
The content on this webpage is sourced from various professional data sources. If you have any questions or concerns regarding the content, please feel free to contact service1@chemsrc.com.