| Name |
3-[5-(Hydroxymethyl)-1,2,4-oxadiazol-3-yl]benzoic acid
|
| Molecular Formula |
C10H8N2O4
|
| Molecular Weight |
220.18
|
| Smiles |
O=C(O)c1cccc(-c2noc(CO)n2)c1
|
O=C(O)c1cccc(-c2noc(CO)n2)c1
The content on this webpage is sourced from various professional data sources. If you have any questions or concerns regarding the content, please feel free to contact service1@chemsrc.com.