| Name |
2-{1-[3-(benzyloxy)-2-({[(9H-fluoren-9-yl)methoxy]carbonyl}amino)butanamido]ethyl}-1,3-thiazole-4-carboxylic acid
|
| Molecular Formula |
C32H31N3O6S
|
| Molecular Weight |
585.7
|
| Smiles |
CC(NC(=O)C(NC(=O)OCC1c2ccccc2-c2ccccc21)C(C)OCc1ccccc1)c1nc(C(=O)O)cs1
|
CC(NC(=O)C(NC(=O)OCC1c2ccccc2-c2ccccc21)C(C)OCc1ccccc1)c1nc(C(=O)O)cs1
The content on this webpage is sourced from various professional data sources. If you have any questions or concerns regarding the content, please feel free to contact service1@chemsrc.com.