| Name |
6-{5-cyclopentanecarbonyl-octahydropyrrolo[3,4-c]pyrrol-2-yl}-9-ethyl-9H-purine
|
| Molecular Formula |
C19H26N6O
|
| Molecular Weight |
354.4
|
| Smiles |
CCn1cnc2c(N3CC4CN(C(=O)C5CCCC5)CC4C3)ncnc21
|
CCn1cnc2c(N3CC4CN(C(=O)C5CCCC5)CC4C3)ncnc21
The content on this webpage is sourced from various professional data sources. If you have any questions or concerns regarding the content, please feel free to contact service1@chemsrc.com.