| Name |
N-(2-{[2-(methylamino)ethyl](2,2,2-trifluoroethyl)amino}ethyl)prop-2-enamide
|
| Molecular Formula |
C10H18F3N3O
|
| Molecular Weight |
253.26
|
| Smiles |
C=CC(=O)NCCN(CCNC)CC(F)(F)F
|
C=CC(=O)NCCN(CCNC)CC(F)(F)F
The content on this webpage is sourced from various professional data sources. If you have any questions or concerns regarding the content, please feel free to contact service1@chemsrc.com.