| Name |
(2R,4S,5R,6R)-5-acetamido-2,4-dihydroxy-6-[(1R,2R)-1,2,3-trihydroxypropyl](2,3,4-13C3)oxane-2-carboxylic acid
|
| Molecular Formula |
C11H19NO9
|
| Molecular Weight |
312.25
|
| Smiles |
CC(=O)NC1C(O)CC(O)(C(=O)O)OC1C(O)C(O)CO
|
CC(=O)NC1C(O)CC(O)(C(=O)O)OC1C(O)C(O)CO
The content on this webpage is sourced from various professional data sources. If you have any questions or concerns regarding the content, please feel free to contact service1@chemsrc.com.