| Name |
3-{[(4-bromothiophen-2-yl)methyl](methyl)carbamoyl}-3-({[(9H-fluoren-9-yl)methoxy]carbonyl}amino)propanoic acid
|
| Molecular Formula |
C25H23BrN2O5S
|
| Molecular Weight |
543.4
|
| Smiles |
CN(Cc1cc(Br)cs1)C(=O)C(CC(=O)O)NC(=O)OCC1c2ccccc2-c2ccccc21
|
CN(Cc1cc(Br)cs1)C(=O)C(CC(=O)O)NC(=O)OCC1c2ccccc2-c2ccccc21
The content on this webpage is sourced from various professional data sources. If you have any questions or concerns regarding the content, please feel free to contact service1@chemsrc.com.