| Name |
tert-butyl N-({1H-pyrazolo[3,4-b]pyridin-3-yl}methyl)carbamate
|
| Molecular Formula |
C12H16N4O2
|
| Molecular Weight |
248.28
|
| Smiles |
CC(C)(C)OC(=O)NCc1[nH]nc2ncccc12
|
CC(C)(C)OC(=O)NCc1[nH]nc2ncccc12
The content on this webpage is sourced from various professional data sources. If you have any questions or concerns regarding the content, please feel free to contact service1@chemsrc.com.