| Name |
5-({[(2R,3S)-1-[(tert-butoxy)carbonyl]-2-methylpyrrolidin-3-yl]({[(9H-fluoren-9-yl)methoxy]carbonyl})amino}methyl)-1,2-oxazole-3-carboxylic acid
|
| Molecular Formula |
C30H33N3O7
|
| Molecular Weight |
547.6
|
| Smiles |
CC1C(N(Cc2cc(C(=O)O)no2)C(=O)OCC2c3ccccc3-c3ccccc32)CCN1C(=O)OC(C)(C)C
|
CC1C(N(Cc2cc(C(=O)O)no2)C(=O)OCC2c3ccccc3-c3ccccc32)CCN1C(=O)OC(C)(C)C
The content on this webpage is sourced from various professional data sources. If you have any questions or concerns regarding the content, please feel free to contact service1@chemsrc.com.