| Name |
2-[(2S)-1-[(tert-butoxy)carbonyl]piperidin-2-yl]-2-{[(4,4-difluorocyclohexyl)methyl]({[(9H-fluoren-9-yl)methoxy]carbonyl})amino}propanoic acid
|
| Molecular Formula |
C35H44F2N2O6
|
| Molecular Weight |
626.7
|
| Smiles |
CC(C)(C)OC(=O)N1CCCCC1C(C)(C(=O)O)N(CC1CCC(F)(F)CC1)C(=O)OCC1c2ccccc2-c2ccccc21
|
CC(C)(C)OC(=O)N1CCCCC1C(C)(C(=O)O)N(CC1CCC(F)(F)CC1)C(=O)OCC1c2ccccc2-c2ccccc21
The content on this webpage is sourced from various professional data sources. If you have any questions or concerns regarding the content, please feel free to contact service1@chemsrc.com.