| Name |
3-[2-(4,4-Difluoropiperidine-1-carbonyl)morpholin-4-yl]-1-methyl-1,2-dihydropyrazin-2-one
|
| Molecular Formula |
C15H20F2N4O3
|
| Molecular Weight |
342.34
|
| Smiles |
Cn1ccnc(N2CCOC(C(=O)N3CCC(F)(F)CC3)C2)c1=O
|
Cn1ccnc(N2CCOC(C(=O)N3CCC(F)(F)CC3)C2)c1=O
The content on this webpage is sourced from various professional data sources. If you have any questions or concerns regarding the content, please feel free to contact service1@chemsrc.com.