| Name |
7-Chloro-1,3-dioxaindane-5-sulfonyl fluoride
|
| Molecular Formula |
C7H4ClFO4S
|
| Molecular Weight |
238.62
|
| Smiles |
O=S(=O)(F)c1cc(Cl)c2c(c1)OCO2
|
O=S(=O)(F)c1cc(Cl)c2c(c1)OCO2
The content on this webpage is sourced from various professional data sources. If you have any questions or concerns regarding the content, please feel free to contact service1@chemsrc.com.