| Name |
Tricyclo[5.2.1.0,2,6]decane-8-sulfonyl fluoride
|
| Molecular Formula |
C10H15FO2S
|
| Molecular Weight |
218.29
|
| Smiles |
O=S(=O)(F)C1CC2CC1C1CCCC21
|
O=S(=O)(F)C1CC2CC1C1CCCC21
The content on this webpage is sourced from various professional data sources. If you have any questions or concerns regarding the content, please feel free to contact service1@chemsrc.com.