| Name |
(3-(Trifluoromethyl)-5,6-dihydro-8H-[1,2,4]triazolo[3,4-c][1,4]oxazin-6-yl)methanamine
|
| Molecular Formula |
C7H9F3N4O
|
| Molecular Weight |
222.17
|
| Smiles |
NCC1Cn2c(nnc2C(F)(F)F)CO1
|
NCC1Cn2c(nnc2C(F)(F)F)CO1
The content on this webpage is sourced from various professional data sources. If you have any questions or concerns regarding the content, please feel free to contact service1@chemsrc.com.