| Name |
4-{[2-({[(9H-fluoren-9-yl)methoxy]carbonyl}amino)-1,3-thiazol-4-yl]formamido}-2-methylbut-2-enoic acid
|
| Molecular Formula |
C24H21N3O5S
|
| Molecular Weight |
463.5
|
| Smiles |
CC(=CCNC(=O)c1csc(NC(=O)OCC2c3ccccc3-c3ccccc32)n1)C(=O)O
|
CC(=CCNC(=O)c1csc(NC(=O)OCC2c3ccccc3-c3ccccc32)n1)C(=O)O
The content on this webpage is sourced from various professional data sources. If you have any questions or concerns regarding the content, please feel free to contact service1@chemsrc.com.