| Name |
2-{[1-({[(9H-fluoren-9-yl)methoxy]carbonyl}amino)cyclopropyl]formamido}-3,3,3-trifluoropropanoic acid
|
| Molecular Formula |
C22H19F3N2O5
|
| Molecular Weight |
448.4
|
| Smiles |
O=C(NC1(C(=O)NC(C(=O)O)C(F)(F)F)CC1)OCC1c2ccccc2-c2ccccc21
|
O=C(NC1(C(=O)NC(C(=O)O)C(F)(F)F)CC1)OCC1c2ccccc2-c2ccccc21
The content on this webpage is sourced from various professional data sources. If you have any questions or concerns regarding the content, please feel free to contact service1@chemsrc.com.