| Name |
2-{4-[(2R)-2-({[(9H-fluoren-9-yl)methoxy]carbonyl}amino)pentanamido]oxan-4-yl}acetic acid
|
| Molecular Formula |
C27H32N2O6
|
| Molecular Weight |
480.6
|
| Smiles |
CCCC(NC(=O)OCC1c2ccccc2-c2ccccc21)C(=O)NC1(CC(=O)O)CCOCC1
|
CCCC(NC(=O)OCC1c2ccccc2-c2ccccc21)C(=O)NC1(CC(=O)O)CCOCC1
The content on this webpage is sourced from various professional data sources. If you have any questions or concerns regarding the content, please feel free to contact service1@chemsrc.com.