| Name |
2-(N-benzyl-1-{5-[({[(9H-fluoren-9-yl)methoxy]carbonyl}amino)methyl]oxolan-2-yl}formamido)acetic acid
|
| Molecular Formula |
C30H30N2O6
|
| Molecular Weight |
514.6
|
| Smiles |
O=C(O)CN(Cc1ccccc1)C(=O)C1CCC(CNC(=O)OCC2c3ccccc3-c3ccccc32)O1
|
O=C(O)CN(Cc1ccccc1)C(=O)C1CCC(CNC(=O)OCC2c3ccccc3-c3ccccc32)O1
The content on this webpage is sourced from various professional data sources. If you have any questions or concerns regarding the content, please feel free to contact service1@chemsrc.com.