| Name |
6,8-Dichloro-5-fluoro-2,7-naphthyridin-1(2H)-one
|
| Molecular Formula |
C8H3Cl2FN2O
|
| Molecular Weight |
233.02
|
| Smiles |
O=c1[nH]ccc2c(F)c(Cl)nc(Cl)c12
|
O=c1[nH]ccc2c(F)c(Cl)nc(Cl)c12
The content on this webpage is sourced from various professional data sources. If you have any questions or concerns regarding the content, please feel free to contact service1@chemsrc.com.