| Name |
2,2-difluoro-1-[2-(1H-1,2,3,4-tetrazol-1-yl)ethyl]cyclopropane-1-carboxylic acid
|
| Molecular Formula |
C7H8F2N4O2
|
| Molecular Weight |
218.16
|
| Smiles |
O=C(O)C1(CCn2cnnn2)CC1(F)F
|
O=C(O)C1(CCn2cnnn2)CC1(F)F
The content on this webpage is sourced from various professional data sources. If you have any questions or concerns regarding the content, please feel free to contact service1@chemsrc.com.