| Name |
1-(2,5-Dimethylfuran-3-yl)-2,2-dimethylcyclopropane-1-carboxylic acid
|
| Molecular Formula |
C12H16O3
|
| Molecular Weight |
208.25
|
| Smiles |
Cc1cc(C2(C(=O)O)CC2(C)C)c(C)o1
|
Cc1cc(C2(C(=O)O)CC2(C)C)c(C)o1
The content on this webpage is sourced from various professional data sources. If you have any questions or concerns regarding the content, please feel free to contact service1@chemsrc.com.