| Name |
Ethyl 2-[2-(1,2,3,3a,4,9b-hexahydrochromeno[4,3-c]pyrazole-3-carbonylamino)-1,3-thiazol-4-yl]acetate
|
| Molecular Formula |
C18H20N4O4S
|
| Molecular Weight |
388.4
|
| Smiles |
CCOC(=O)Cc1csc(NC(=O)C2NNC3c4ccccc4OCC23)n1
|
CCOC(=O)Cc1csc(NC(=O)C2NNC3c4ccccc4OCC23)n1
The content on this webpage is sourced from various professional data sources. If you have any questions or concerns regarding the content, please feel free to contact service1@chemsrc.com.